|
CAS#: 22581-06-2 Product: 3-Chloro-4,6-Dihydroxy-2-Methyl-5-[(2E,6E)-3,7,11-Trimethyl-2,6,10-Dodecatrienyl]Benzaldehyde No suppilers available for the product. |
| Name | 3-Chloro-4,6-Dihydroxy-2-Methyl-5-[(2E,6E)-3,7,11-Trimethyl-2,6,10-Dodecatrienyl]Benzaldehyde |
|---|---|
| Synonyms | Ilicicolin A; Ll-Z 1272-Alpha; Beta-Resorcylaldehyde, 5-Chloro-6-Methyl-3-(3,7,11-Trimethyl-2,6,10-Dodecatrienyl)- (8Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C23H31ClO3 |
| Molecular Weight | 390.95 |
| CAS Registry Number | 22581-06-2 |
| SMILES | C(C1=C(O)C(=C(C(=C1O)C=O)C)Cl)\C=C(\CC\C=C(\CCC=C(C)C)C)C |
| InChI | 1S/C23H31ClO3/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-19-22(26)20(14-25)18(5)21(24)23(19)27/h8,10,12,14,26-27H,6-7,9,11,13H2,1-5H3/b16-10+,17-12+ |
| InChIKey | MHWOMRMBQGSTFS-JTCWOHKRSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.093°C at 760 mmHg (Cal.) |
| Flash point | 275.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-4,6-Dihydroxy-2-Methyl-5-[(2E,6E)-3,7,11-Trimethyl-2,6,10-Dodecatrienyl]Benzaldehyde |