|
CAS#: 22606-98-0 Product: 1-(4-Methoxybenzyl)-3,3-Dimethyl-2-Phenylazetidine No suppilers available for the product. |
| Name | 1-(4-Methoxybenzyl)-3,3-Dimethyl-2-Phenylazetidine |
|---|---|
| Synonyms | 1-(4-Methoxybenzyl)-3,3-dimethyl-2-phenylazetidine # |
| Molecular Structure | ![]() |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.39 |
| CAS Registry Number | 22606-98-0 |
| SMILES | O(c1ccc(cc1)CN3C(c2ccccc2)C(C3)(C)C)C |
| InChI | 1S/C19H23NO/c1-19(2)14-20(18(19)16-7-5-4-6-8-16)13-15-9-11-17(21-3)12-10-15/h4-12,18H,13-14H2,1-3H3 |
| InChIKey | URNXUOFQEARGGF-UHFFFAOYSA-N |
| Density | 1.054g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.4°C at 760 mmHg (Cal.) |
| Flash point | 110.395°C (Cal.) |
| Refractive index | 1.565 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Methoxybenzyl)-3,3-Dimethyl-2-Phenylazetidine |