Online Database of Chemicals from Around the World
|
CAS#: 22621-40-5 Product: Methyl O-Acetyl-5-Iodosalicylate No suppilers available for the product. |
| Name | Methyl O-Acetyl-5-Iodosalicylate |
|---|---|
| Synonyms | Methyl 5-Acetoxy-2-Iodo-Benzoate; 5-Acetoxy-2-Iodobenzoic Acid Methyl Ester; 5-Acetoxy-2-Iodo-Benzoic Acid Methyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H9IO4 |
| Molecular Weight | 320.08 |
| CAS Registry Number | 22621-40-5 |
| EINECS | 245-136-3 |
| SMILES | C1=C(OC(=O)C)C=CC(=C1C(=O)OC)I |
| InChI | 1S/C10H9IO4/c1-6(12)15-7-3-4-9(11)8(5-7)10(13)14-2/h3-5H,1-2H3 |
| InChIKey | HRVZFEACPOXONC-UHFFFAOYSA-N |
| Density | 1.711g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.904°C at 760 mmHg (Cal.) |
| Flash point | 162.997°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl O-Acetyl-5-Iodosalicylate |