|
CAS#: 22621-42-7 Product: Methyl 2-Acetoxy-3-Nitrobenzoate No suppilers available for the product. |
| Name | Methyl 2-Acetoxy-3-Nitrobenzoate |
|---|---|
| Synonyms | Methyl 2-(acetyloxy)-3-nitrobenzoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO6 |
| Molecular Weight | 239.18 |
| CAS Registry Number | 22621-42-7 |
| SMILES | O=C(Oc1c(cccc1[N+]([O-])=O)C(=O)OC)C |
| InChI | 1S/C10H9NO6/c1-6(12)17-9-7(10(13)16-2)4-3-5-8(9)11(14)15/h3-5H,1-2H3 |
| InChIKey | WGKSBSULRFMNQF-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.848°C at 760 mmHg (Cal.) |
| Flash point | 152.019°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Acetoxy-3-Nitrobenzoate |