|
CAS#: 22644-62-8 Product: 5beta-Isopropyl-5alpha-(1-Methoxyethyl)-2beta-Phenyl-1,3-Dioxane No suppilers available for the product. |
| Name | 5beta-Isopropyl-5alpha-(1-Methoxyethyl)-2beta-Phenyl-1,3-Dioxane |
|---|---|
| Synonyms | 5-Isopropyl-5-(1-Methoxyethyl)-2-Phenyl-1,3-Dioxane; 5-19-02-00588 (Beilstein Handbook Reference); Brn 1312392 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 |
| CAS Registry Number | 22644-62-8 (22644-63-9) |
| SMILES | [C@]1(COC(OC1)C2=CC=CC=C2)(C(OC)C)C(C)C |
| InChI | 1S/C16H24O3/c1-12(2)16(13(3)17-4)10-18-15(19-11-16)14-8-6-5-7-9-14/h5-9,12-13,15H,10-11H2,1-4H3/t13?,15?,16- |
| InChIKey | MLBRCQKWCHCCTD-SJFYVEPLSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.225°C at 760 mmHg (Cal.) |
| Flash point | 113.96°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5beta-Isopropyl-5alpha-(1-Methoxyethyl)-2beta-Phenyl-1,3-Dioxane |