|
CAS#: 226930-26-3 Product: Ethyl 4-(1-Naphthyl)-1H-Pyrrole-3-Carboxylate No suppilers available for the product. |
| Name | Ethyl 4-(1-Naphthyl)-1H-Pyrrole-3-Carboxylate |
|---|---|
| Synonyms | 1H-Pyrrole-3-carboxylicacid,4-(1-naphthalenyl)-,ethylester |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 |
| CAS Registry Number | 226930-26-3 |
| SMILES | O=C(OCC)c3c(c1cccc2c1cccc2)cnc3 |
| InChI | 1S/C17H15NO2/c1-2-20-17(19)16-11-18-10-15(16)14-9-5-7-12-6-3-4-8-13(12)14/h3-11,18H,2H2,1H3 |
| InChIKey | RPMKLIJEJHONCN-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.638°C at 760 mmHg (Cal.) |
| Flash point | 254.158°C (Cal.) |
| Refractive index | 1.637 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-(1-Naphthyl)-1H-Pyrrole-3-Carboxylate |