|
CAS#: 22703-31-7 Product: 2-Amino-7,7,9-Trimethyl-1-Oxa-3-Azaspiro[4.5]Dec-2-En-4-One No suppilers available for the product. |
| Name | 2-Amino-7,7,9-Trimethyl-1-Oxa-3-Azaspiro[4.5]Dec-2-En-4-One |
|---|---|
| Synonyms | Brn 0981509; 1-Oxa-3-Azaspiro(4.5)Dec-2-En-4-One, 2-Amino-7,7,9-Trimethyl-; 2-Amino-7,7,9-Trimethyl-1-Oxa-3-Azaspiro(4.5)Dec-2-En-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 |
| CAS Registry Number | 22703-31-7 |
| SMILES | CC2CC(CC1(OC(=NC1=O)N)C2)(C)C |
| InChI | 1S/C11H18N2O2/c1-7-4-10(2,3)6-11(5-7)8(14)13-9(12)15-11/h7H,4-6H2,1-3H3,(H2,12,13,14) |
| InChIKey | DHSNTXXTGPWZJO-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.344°C at 760 mmHg (Cal.) |
| Flash point | 133.629°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-7,7,9-Trimethyl-1-Oxa-3-Azaspiro[4.5]Dec-2-En-4-One |