|
CAS#: 22731-72-2 Product: 1-(4'-Nitrophenyl)Prop-2-En-1-One No suppilers available for the product. |
| Name | 1-(4'-Nitrophenyl)Prop-2-En-1-One |
|---|---|
| Synonyms | 1-(4'-Nitrophenyl)Prop-2-En-1-One; 2-Propen-1-One, 1-(4-Nitrophenyl)-; Np-Peo |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 |
| CAS Registry Number | 22731-72-2 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1)C(=O)C=C |
| InChI | 1S/C9H7NO3/c1-2-9(11)7-3-5-8(6-4-7)10(12)13/h2-6H,1H2 |
| InChIKey | DQYLFLJHEBERCG-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.818°C at 760 mmHg (Cal.) |
| Flash point | 156.136°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4'-Nitrophenyl)Prop-2-En-1-One |