|
CAS#: 22802-40-0 Product: 2,6-Dibromo-3,4-Xylenol No suppilers available for the product. |
| Name | 2,6-Dibromo-3,4-Xylenol |
|---|---|
| Synonyms | 2,6-Dibromo-3,4-Dimethyl-Phenol; 2,6-Dibromo-3,4-Xylenol |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8Br2O |
| Molecular Weight | 279.96 |
| CAS Registry Number | 22802-40-0 |
| EINECS | 245-229-9 |
| SMILES | C1=C(C(=C(C(=C1C)C)Br)O)Br |
| InChI | 1S/C8H8Br2O/c1-4-3-6(9)8(11)7(10)5(4)2/h3,11H,1-2H3 |
| InChIKey | KIVOOVZNPGTYDM-UHFFFAOYSA-N |
| Density | 1.832g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.964°C at 760 mmHg (Cal.) |
| Flash point | 114.046°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dibromo-3,4-Xylenol |