|
CAS#: 2283-43-4 Product: (2S)-2-Amino-3-(5-Methyl-1H-Indol-3-Yl)Propanoic Acid No suppilers available for the product. |
| Name | (2S)-2-Amino-3-(5-Methyl-1H-Indol-3-Yl)Propanoic Acid |
|---|---|
| Synonyms | (2S)-2-Amino-3-(5-Methyl-1H-Indol-3-Yl)Propionic Acid; 5-Methyltryptophan; Tryptophan, 5-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25 |
| CAS Registry Number | 2283-43-4 |
| SMILES | [C@H](C(=O)O)(N)CC1=C[NH]C2=CC=C(C=C12)C |
| InChI | 1S/C12H14N2O2/c1-7-2-3-11-9(4-7)8(6-14-11)5-10(13)12(15)16/h2-4,6,10,14H,5,13H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | HUNCSWANZMJLPM-JTQLQIEISA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.134°C at 760 mmHg (Cal.) |
| Flash point | 229.057°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-Amino-3-(5-Methyl-1H-Indol-3-Yl)Propanoic Acid |