Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | N-[4-(1-Pyrenyl)Butanoyl]Glycylphenylalanine |
|---|---|
| Synonyms | N-4-(1-Pyrene)butyroylglycyl-L-phenylalanine |
| Molecular Structure | ![CAS#: 228414-52-6, N-[4-(1-Pyrenyl)Butanoyl]Glycylphenylalanine](/moreStructures/228414-52-6.gif) |
| Molecular Formula | C31H28N2O4 |
| Molecular Weight | 492.57 |
| CAS Registry Number | 228414-52-6 |
| SMILES | O=C(NCC(=O)NC(C(=O)O)Cc1ccccc1)CCCc5c2c4c3c(cc2)cccc3ccc4cc5 |
| InChI | 1S/C31H28N2O4/c34-27(32-19-28(35)33-26(31(36)37)18-20-6-2-1-3-7-20)11-5-8-21-12-13-24-15-14-22-9-4-10-23-16-17-25(21)30(24)29(22)23/h1-4,6-7,9-10,12-17,26H,5,8,11,18-19H2,(H,32,34)(H,33,35)(H,36,37) |
| InChIKey | YRYXBJSINXOFKS-UHFFFAOYSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 840.719°C at 760 mmHg (Cal.) |
| Flash point | 462.25°C (Cal.) |
| Refractive index | 1.71 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(1-Pyrenyl)Butanoyl]Glycylphenylalanine |