| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Phenanthren-4-Methanol |
|---|---|
| Synonyms | 4-Phenanthrylmethanol; Phenanthren-4-Methanol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 |
| CAS Registry Number | 22863-79-2 |
| EINECS | 245-270-2 |
| SMILES | C1=CC=CC2=CC=C3C(=C12)C(=CC=C3)CO |
| InChI | 1S/C15H12O/c16-10-13-6-3-5-12-9-8-11-4-1-2-7-14(11)15(12)13/h1-9,16H,10H2 |
| InChIKey | UJSGLVQRVAPNIY-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.386°C at 760 mmHg (Cal.) |
| Flash point | 196.281°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | R. E. Gerkin. Hydrogen bonding and C-H...O interactions in 4-phenanthrenemethanol at 150Â K, Acta Cryst. (2000). C56, 1287-1288 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phenanthren-4-Methanol |