|
CAS#: 22888-59-1 Product: Methyl L-Argininate Hydrochloride (1:1) No suppilers available for the product. |
| Name | Methyl L-Argininate Hydrochloride (1:1) |
|---|---|
| Synonyms | (S)-Methyl 2-amino-5-guanidinopentanoate hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H17ClN4O2 |
| Molecular Weight | 224.69 |
| CAS Registry Number | 22888-59-1 |
| SMILES | N[C@@H](CCCNC(N)=N)C(=O)OC.Cl |
| InChI | 1S/C7H16N4O2.ClH/c1-13-6(12)5(8)3-2-4-11-7(9)10;/h5H,2-4,8H2,1H3,(H4,9,10,11);1H/t5-;/m0./s1 |
| InChIKey | XKVHMRBXIJTLBM-JEDNCBNOSA-N |
| Boiling point | 331.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 154.1°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl L-Argininate Hydrochloride (1:1) |