Online Database of Chemicals from Around the World
|
CAS#: 22905-22-2 Product: 2,5-Dichloro-1-Hydroxy-3,6-Dimethoxy-8-Methyl-Xanthen-9-One No suppilers available for the product. |
| Name | 2,5-Dichloro-1-Hydroxy-3,6-Dimethoxy-8-Methyl-Xanthen-9-One |
|---|---|
| Synonyms | 2,5-Dichloro-1-Hydroxy-3,6-Dimethoxy-8-Methyl-Xanthen-9-One; 2,5-Dichloro-1-Hydroxy-3,6-Dimethoxy-8-Methyl-9-Xanthenone; 2,5-Dichloro-1-Hydroxy-3,6-Dimethoxy-8-Methyl-Xanthone |
| Molecular Structure |  |
| Molecular Formula | C16H12Cl2O5 |
| Molecular Weight | 355.17 |
| CAS Registry Number | 22905-22-2 |
| SMILES | C1=C(C(=C(C3=C1OC2=C(C(=CC(=C2C3=O)C)OC)Cl)O)Cl)OC |
| InChI | 1S/C16H12Cl2O5/c1-6-4-8(21-2)13(18)16-10(6)14(19)11-7(23-16)5-9(22-3)12(17)15(11)20/h4-5,20H,1-3H3 |
| InChIKey | IXVOEBPULFILGH-UHFFFAOYSA-N |
| Density | 1.479g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.459°C at 760 mmHg (Cal.) |
| Flash point | 284.289°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dichloro-1-Hydroxy-3,6-Dimethoxy-8-Methyl-Xanthen-9-One |