|
CAS#: 22919-58-0 Product: 2',4'-Dihydroxypropiophenone Oxime No suppilers available for the product. |
| Name | 2',4'-Dihydroxypropiophenone Oxime |
|---|---|
| Synonyms | (4Z)-3-Hydroxy-4-[1-(Hydroxyamino)Propylidene]-1-Cyclohexa-2,5-Dienone; 1-Propanone, 1-(2,4-Dihydroxyphenyl)-, Oxime; 2,4-Dihydroxypropiophenone Oxime |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 |
| CAS Registry Number | 22919-58-0 |
| EINECS | 245-328-7 |
| SMILES | C(\C(NO)=C1\C(=CC(=O)C=C1)O)C |
| InChI | 1S/C9H11NO3/c1-2-8(10-13)7-4-3-6(11)5-9(7)12/h3-5,10,12-13H,2H2,1H3/b8-7- |
| InChIKey | ZVONSIRWAQNJKJ-FPLPWBNLSA-N |
| Density | 1.365g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.721°C at 760 mmHg (Cal.) |
| Flash point | 133.857°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2',4'-Dihydroxypropiophenone Oxime |