|
CAS#: 23022-40-4 Product: 1H-Inden-1-Yltrimethyl-Stannane No suppilers available for the product. |
| Name | 1H-Inden-1-Yltrimethyl-Stannane |
|---|---|
| Synonyms | 1H-Inden-1-Yl-Trimethyl-Stannane; Stannane, 1H-Inden-1-Yltrimethyl-; Stannane,1H-Inden-1-Yltrimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16Sn |
| Molecular Weight | 278.95 |
| CAS Registry Number | 23022-40-4 |
| SMILES | C1=CC=C2C(=C1)C=CC2[Sn](C)(C)C |
| InChI | 1S/C9H7.3CH3.Sn/c1-2-5-9-7-3-6-8(9)4-1;;;;/h1-7H;3*1H3; |
| InChIKey | GWWFMBNBRVZBPC-UHFFFAOYSA-N |
| Boiling point | 293.051°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 134.48°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Inden-1-Yltrimethyl-Stannane |