Online Database of Chemicals from Around the World
|
CAS#: 23027-48-7 Product: (6R,7S)-8,8-Dimethyl-2-Oxo-7,8-Dihydro-2H,6H-Pyrano[3,2-g]Chromene-6,7-Diyl Bis(3-Methyl-2-Butenoate) No suppilers available for the product. |
| Name | (6R,7S)-8,8-Dimethyl-2-Oxo-7,8-Dihydro-2H,6H-Pyrano[3,2-g]Chromene-6,7-Diyl Bis(3-Methyl-2-Butenoate) |
|---|---|
| Synonyms | decursidin |
| Molecular Structure | ![CAS#: 23027-48-7, (6R,7S)-8,8-Dimethyl-2-Oxo-7,8-Dihydro-2H,6H-Pyrano[3,2-g]Chromene-6,7-Diyl Bis(3-Methyl-2-Butenoate)](/moreStructures/23027-48-7.gif) |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.46 |
| CAS Registry Number | 23027-48-7 |
| SMILES | C/C(C)=C\C(=O)O[C@@H]1c2cc3/C=C\C(=O)Oc3cc2O[C@](C)(C)[C@H]1OC(=O)\C=C(/C)C |
| InChI | 1S/C24H26O7/c1-13(2)9-20(26)29-22-16-11-15-7-8-19(25)28-17(15)12-18(16)31-24(5,6)23(22)30-21(27)10-14(3)4/h7-12,22-23H,1-6H3/t22-,23+/m1/s1 |
| InChIKey | SYRXQLPUGCYKFH-PKTZIBPZSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.45°C at 760 mmHg (Cal.) |
| Flash point | 229.887°C (Cal.) |
| Refractive index | 1.573 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (6R,7S)-8,8-Dimethyl-2-Oxo-7,8-Dihydro-2H,6H-Pyrano[3,2-g]Chromene-6,7-Diyl Bis(3-Methyl-2-Butenoate) |