|
CAS#: 23059-38-3 Product: Methyl 1,4-Dimethylcyclohexanecarboxylate No suppilers available for the product. |
| Name | Methyl 1,4-Dimethylcyclohexanecarboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 |
| CAS Registry Number | 23059-38-3 |
| SMILES | C[C@H]1CC[C@](CC1)(C(=O)OC)C |
| InChI | 1S/C10H18O2/c1-8-4-6-10(2,7-5-8)9(11)12-3/h8H,4-7H2,1-3H3/t8-,10+ |
| InChIKey | YLQLGTFGVSLQJL-WAAGHKOSSA-N |
| Density | 0.933g/cm3 (Cal.) |
|---|---|
| Boiling point | 196.144°C at 760 mmHg (Cal.) |
| Flash point | 71.513°C (Cal.) |
| Refractive index | 1.438 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 1,4-Dimethylcyclohexanecarboxylate |