|
CAS#: 23064-32-6 Product: 4-Phenyl-2,3-Dihydroxy-2-Buten-4-Olide No suppilers available for the product. |
| Name | 4-Phenyl-2,3-Dihydroxy-2-Buten-4-Olide |
|---|---|
| Synonyms | 4,5-Dihydroxy-2-Phenyl-Furan-3-One; 4,5-Dihydroxy-2-Phenyl-3-Furanone; 2(5H)-Furanone, 3,4-Dihydroxy-5-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 |
| CAS Registry Number | 23064-32-6 |
| SMILES | C2=C(C1OC(=C(O)C1=O)O)C=CC=C2 |
| InChI | 1S/C10H8O4/c11-7-8(12)10(13)14-9(7)6-4-2-1-3-5-6/h1-5,9,12-13H |
| InChIKey | TWOAMASAGTWLQD-UHFFFAOYSA-N |
| Density | 1.554g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.444°C at 760 mmHg (Cal.) |
| Flash point | 138.657°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Phenyl-2,3-Dihydroxy-2-Buten-4-Olide |