| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Synchem OHG | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (5662) 40873-0 | |||
![]() |
info@synchem.de | |||
| Chemical manufacturer | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | Pyrazino[2,3-f]Quinoxaline |
|---|---|
| Synonyms | Zinc02539651; 1,4,5,8-Tetraaza-Phenanthrene |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6N4 |
| Molecular Weight | 182.18 |
| CAS Registry Number | 231-23-2 |
| SMILES | C1=CC3=C(C2=C1N=CC=N2)N=CC=N3 |
| InChI | 1S/C10H6N4/c1-2-8-10(14-6-4-12-8)9-7(1)11-3-5-13-9/h1-6H |
| InChIKey | CVSGFMWKZVZOJD-UHFFFAOYSA-N |
| Density | 1.395g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.09°C at 760 mmHg (Cal.) |
| Flash point | 182.184°C (Cal.) |
| (1) | Feng-Rong Dai, Jing-Lin Chen, Heng-Yun Ye, Li-Yi Zhang and Zhong-Ning Chen. Syntheses, characterization and redox properties of oxo-centred trirutheniumcluster dimers and trimers linked by ortho-metallated polypyridyl ligands, Dalton Trans., 2008, 1492. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Pyrazino[2,3-f]Quinoxaline |