|
CAS#: 23107-11-1 Product: Dehydroheliotrine No suppilers available for the product. |
| Name | Dehydroheliotrine |
|---|---|
| Synonyms | [(7S)-7-Hydroxy-6,7-Dihydro-5H-Pyrrolizin-1-Yl]Methyl 2-Hydroxy-2-Isopropyl-3-Methoxy-Butanoate; 2-Hydroxy-2-Isopropyl-3-Methoxybutanoic Acid [(7S)-7-Hydroxy-6,7-Dihydro-5H-Pyrrolizin-1-Yl]Methyl Ester; 2-Hydroxy-2-Isopropyl-3-Methoxy-Butyric Acid [(7S)-7-Hydroxy-6,7-Dihydro-5H-Pyrrolizin-1-Yl]Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 |
| CAS Registry Number | 23107-11-1 |
| SMILES | [C@H]2(C1=C(C=C[N]1CC2)COC(C(C(OC)C)(C(C)C)O)=O)O |
| InChI | 1S/C16H25NO5/c1-10(2)16(20,11(3)21-4)15(19)22-9-12-5-7-17-8-6-13(18)14(12)17/h5,7,10-11,13,18,20H,6,8-9H2,1-4H3/t11?,13-,16?/m0/s1 |
| InChIKey | KYSOVPPHGLNVRV-ULKWEWGCSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.564°C at 760 mmHg (Cal.) |
| Flash point | 251.089°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dehydroheliotrine |