|
CAS#: 23147-81-1 Product: 4,4-Dibenzyl-3,5-Dimethyl-4H-Pyrazole No suppilers available for the product. |
| Name | 4,4-Dibenzyl-3,5-Dimethyl-4H-Pyrazole |
|---|---|
| Synonyms | 4,4-Dibenzyl-3,5-dimethyl-4H-pyrazole # |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 |
| CAS Registry Number | 23147-81-1 |
| SMILES | N=1\N=C(/C(C=1C)(Cc2ccccc2)Cc3ccccc3)C |
| InChI | 1S/C19H20N2/c1-15-19(16(2)21-20-15,13-17-9-5-3-6-10-17)14-18-11-7-4-8-12-18/h3-12H,13-14H2,1-2H3 |
| InChIKey | URFRTPANSKYVIW-UHFFFAOYSA-N |
| Density | 1.039g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.385°C at 760 mmHg (Cal.) |
| Flash point | 190.868°C (Cal.) |
| Refractive index | 1.582 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dibenzyl-3,5-Dimethyl-4H-Pyrazole |