|
CAS#: 232-95-1 Product: Benzo[e][1]Benzoxole No suppilers available for the product. |
| Name | Benzo[e][1]Benzoxole |
|---|---|
| Synonyms | Benzo[E]Benzofuran; 3-Oxa-3H-Benz[E]Indene; Naphtho[2,1-B]Furan |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8O |
| Molecular Weight | 168.19 |
| CAS Registry Number | 232-95-1 |
| EINECS | 205-938-6 |
| SMILES | C1=COC2=CC=C3C(=C12)C=CC=C3 |
| InChI | 1S/C12H8O/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12/h1-8H |
| InChIKey | MFMVRILBADIIJO-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.999°C at 760 mmHg (Cal.) |
| Flash point | 139.654°C (Cal.) |
| (1) | Hisahiro Hagiwara, Kouji Sato, Daisuke Nishino, Takashi Hoshi, Toshio Suzuki and Masayoshi Ando. Domino Michael–O-alkylation reaction: one-pot synthesis of 2,4-diacylhydrofuran derivatives and its application to antitumor naphthofuran synthesis, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 2946. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Benzo[e][1]Benzoxole |