Online Database of Chemicals from Around the World
|
CAS#: 2320-44-7 Product: 2',3',6',7'-Tetrahydroxyspiro[2-Benzofuran-3,9'-Xanthene]-1-One No suppilers available for the product. |
| Name | 2',3',6',7'-Tetrahydroxyspiro[2-Benzofuran-3,9'-Xanthene]-1-One |
|---|---|
| Synonyms | 2',3',6',7'-Tetrahydroxyspiro[Isobenzofuran-3,9'-Xanthene]-1-One; 2',3',6',7'-Tetrahydroxy-1-Spiro[Isobenzofuran-3,9'-Xanthene]One; 2-Hydroxyhydroquinonephthalein |
| Molecular Structure | ![CAS#: 2320-44-7, 2',3',6',7'-Tetrahydroxyspiro[2-Benzofuran-3,9'-Xanthene]-1-One](/moreStructures/2320-44-7.gif) |
| Molecular Formula | C20H12O7 |
| Molecular Weight | 364.31 |
| CAS Registry Number | 2320-44-7 |
| SMILES | C5=C4C1(OC(=O)C2=CC=CC=C12)C3=CC(=C(O)C=C3OC4=CC(=C5O)O)O |
| InChI | 1S/C20H12O7/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,21-24H |
| InChIKey | NOEDKKNPNZIYTI-UHFFFAOYSA-N |
| Density | 1.811g/cm3 (Cal.) |
|---|---|
| Boiling point | 740.654°C at 760 mmHg (Cal.) |
| Flash point | 274.896°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2',3',6',7'-Tetrahydroxyspiro[2-Benzofuran-3,9'-Xanthene]-1-One |