Online Database of Chemicals from Around the World
|
CAS#: 23218-62-4 Product: 2,4,5-Trichlorophenyl 4-Methoxybenzyl Carbonate No suppilers available for the product. |
| Name | 2,4,5-Trichlorophenyl 4-Methoxybenzyl Carbonate |
|---|---|
| Synonyms | Carbonic Acid (4-Methoxyphenyl)Methyl (2,4,5-Trichlorophenyl) Ester; Carbonic Acid (4-Methoxybenzyl) (2,4,5-Trichlorophenyl) Ester; 2,4,5-Trichlorophenyl P-Methoxybenzyl Carbonate |
| Molecular Structure |  |
| Molecular Formula | C15H11Cl3O4 |
| Molecular Weight | 361.61 |
| CAS Registry Number | 23218-62-4 |
| EINECS | 245-499-8 |
| SMILES | C1=C(Cl)C(=CC(=C1OC(OCC2=CC=C(C=C2)OC)=O)Cl)Cl |
| InChI | 1S/C15H11Cl3O4/c1-20-10-4-2-9(3-5-10)8-21-15(19)22-14-7-12(17)11(16)6-13(14)18/h2-7H,8H2,1H3 |
| InChIKey | UDCSECKCIHHFRO-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.429°C at 760 mmHg (Cal.) |
| Flash point | 185.652°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5-Trichlorophenyl 4-Methoxybenzyl Carbonate |