|
CAS#: 23230-37-7 Product: Methyl 2,3-Dibromo-3-(4-Phenylphenyl)Propanoate No suppilers available for the product. |
| Name | Methyl 2,3-Dibromo-3-(4-Phenylphenyl)Propanoate |
|---|---|
| Synonyms | 2,3-Dibromo-3-(4-Phenylphenyl)Propanoic Acid Methyl Ester; 2,3-Dibromo-3-(4-Phenylphenyl)Propionic Acid Methyl Ester; Nsc314070 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14Br2O2 |
| Molecular Weight | 398.09 |
| CAS Registry Number | 23230-37-7 |
| SMILES | C1=CC(=CC=C1C(C(C(OC)=O)Br)Br)C2=CC=CC=C2 |
| InChI | 1S/C16H14Br2O2/c1-20-16(19)15(18)14(17)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10,14-15H,1H3 |
| InChIKey | BFVUBBSFCUIRSC-UHFFFAOYSA-N |
| Density | 1.583g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.255°C at 760 mmHg (Cal.) |
| Flash point | 207.963°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2,3-Dibromo-3-(4-Phenylphenyl)Propanoate |