|
CAS#: 23246-32-4 Product: 2-(4-Chlorophenyl)-3,1-Benzoxazepine No suppilers available for the product. |
| Name | 2-(4-Chlorophenyl)-3,1-Benzoxazepine |
|---|---|
| Synonyms | 2-(4-Chlorophenyl)-3,1-benzoxazepine # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10ClNO |
| Molecular Weight | 255.70 |
| CAS Registry Number | 23246-32-4 |
| SMILES | Clc3ccc(C\1=N\c2ccccc2/C=C\O/1)cc3 |
| InChI | 1S/C15H10ClNO/c16-13-7-5-12(6-8-13)15-17-14-4-2-1-3-11(14)9-10-18-15/h1-10H |
| InChIKey | FFJZTRNXXLWXGB-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.369°C at 760 mmHg (Cal.) |
| Flash point | 186.26°C (Cal.) |
| Refractive index | 1.616 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chlorophenyl)-3,1-Benzoxazepine |