|
CAS#: 23255-59-6 Product: Lunularic Acid No suppilers available for the product. |
| Name | Lunularic Acid |
|---|---|
| Synonyms | C10268; Lunularic Acid; 2-Hydroxy-6-(2-(4-Hydroxyphenyl)Ethyl)Benzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 |
| CAS Registry Number | 23255-59-6 |
| SMILES | C2=C(CCC1=CC=C(O)C=C1)C(=C(O)C=C2)C(O)=O |
| InChI | 1S/C15H14O4/c16-12-8-5-10(6-9-12)4-7-11-2-1-3-13(17)14(11)15(18)19/h1-3,5-6,8-9,16-17H,4,7H2,(H,18,19) |
| InChIKey | GFSQDOUEUWXRSL-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.2±40.0°C at 760 mmHg (Cal.) |
| Flash point | 242.0±23.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lunularic Acid |