|
CAS#: 23356-91-4 Product: (S)-2-Amino-1,5-Pentanedithiol hydrochloride No suppilers available for the product. |
| Name | (S)-2-Amino-1,5-Pentanedithiol hydrochloride |
|---|---|
| Synonyms | 2-Aminopentan-1,5-Dithiol; Ec 27; Ec-27 |
| Molecular Structure | ![]() |
| Molecular Formula | C5H14ClNS2 |
| Molecular Weight | 187.75 |
| CAS Registry Number | 23356-91-4 |
| SMILES | [C@H](N)(CCCS)CS.[H+].[Cl-] |
| InChI | 1S/C5H13NS2.ClH/c6-5(4-8)2-1-3-7;/h5,7-8H,1-4,6H2;1H/t5-;/m0./s1 |
| InChIKey | GOVZCYBMQXNFOL-JEDNCBNOSA-N |
| Boiling point | 253.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 107.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (S)-2-Amino-1,5-Pentanedithiol hydrochloride |