Online Database of Chemicals from Around the World
|
CAS#: 23412-26-2 Product: Tolypomycin Y No suppilers available for the product. |
| Name | Tolypomycin Y |
|---|---|
| Synonyms | Tolypomycin Y; NCI60_001483 |
| Molecular Structure |  |
| Molecular Formula | C43H54N2O14 |
| Molecular Weight | 822.89 |
| CAS Registry Number | 23412-26-2 |
| SMILES | O=C5c2c3C(\NC1C(OC(O)CC1)C)=CC\4=N\C(=O)C(=CC(=O)C6CC6C(O)C(C)C(O)C(C)C(OC(=O)C)C(C)C(OC)C=COC5(Oc2c(c(O)c3C/4=O)C)C)C |
| InChI | 1S/C43H54N2O14/c1-17-14-29(47)24-15-25(24)36(50)19(3)35(49)20(4)39(58-23(7)46)18(2)30(55-9)12-13-56-43(8)41(53)34-32-27(44-26-10-11-31(48)57-22(26)6)16-28(45-42(17)54)38(52)33(32)37(51)21(5)40(34)59-43/h12-14,16,18-20,22,24-26,30-31,35-36,39,44,48-51H,10-11,15H2,1-9H3/b13-12?,17-14?,45-28- |
| InChIKey | RQOUZXCGBFCFKU-QAGKJBSQSA-N |
| Density | 1.453g/cm3 (Cal.) |
|---|---|
| Boiling point | 995.469°C at 760 mmHg (Cal.) |
| Flash point | 555.84°C (Cal.) |
| Refractive index | 1.644 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tolypomycin Y |