|
CAS#: 23417-67-6 Product: 5,7-Dichloro-2-Naphtylamine No suppilers available for the product. |
| Name | 5,7-Dichloro-2-Naphtylamine |
|---|---|
| Synonyms | 5,7-Dichloro-2-Naphthalenamine; (5,7-Dichloro-2-Naphthyl)Amine; 5,7-Dichloro-2-Naphthylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7Cl2N |
| Molecular Weight | 212.08 |
| CAS Registry Number | 23417-67-6 |
| SMILES | C1=C(Cl)C2=C(C=C1Cl)C=C(C=C2)N |
| InChI | 1S/C10H7Cl2N/c11-7-3-6-4-8(13)1-2-9(6)10(12)5-7/h1-5H,13H2 |
| InChIKey | DSLZCMZADMRBGM-UHFFFAOYSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.845°C at 760 mmHg (Cal.) |
| Flash point | 180.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Dichloro-2-Naphtylamine |