Online Database of Chemicals from Around the World
|
CAS#: 23442-21-9 Product: 3-Butoxy-4-Nitrobenzoyl Chloride No suppilers available for the product. |
| Name | 3-Butoxy-4-Nitrobenzoyl Chloride |
|---|---|
| Synonyms | 3-Butoxy-4-nitrobenzoyl chloride; 3-Butoxy-4-nitrobenzoylchlorid |
| Molecular Structure |  |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 |
| CAS Registry Number | 23442-21-9 |
| SMILES | CCCCOc1cc(ccc1[N+](=O)[O-])C(=O)Cl |
| InChI | 1S/C11H12ClNO4/c1-2-3-6-17-10-7-8(11(12)14)4-5-9(10)13(15)16/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | RSUQWBCEFFWCAD-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.6±22.0°C at 760 mmHg (Cal.) |
| Flash point | 179.7±22.3°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Butoxy-4-Nitrobenzoyl Chloride |