| Apollo Scientific Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (161) 406-0505 | |||
![]() |
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Dalton Pharma Services | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (416) 661-2102 | |||
![]() |
chemist@dalton.com | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| LKT Laboratories, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (888) 558-5227 | |||
![]() |
peacerli@mbolin-lktlabs.com | |||
| Chemical manufacturer | ||||
| Classification | Analytical chemistry >> Standard >> Food and cosmetics standards |
|---|---|
| Name | Alternariol Monomethyl Ether |
| Synonyms | 3,7-Dihydroxy-9-Methoxy-1-Methyl-Benzo[C]Isochromen-6-One; 3,7-Dihydroxy-9-Methoxy-1-Methyl-6-Benzo[C]Isochromenone; 3,7-Dihydroxy-9-Methoxy-1-Methyl-6H-Dibenzo(B,D)Pyran-6-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 |
| CAS Registry Number | 23452-05-3 |
| SMILES | C1=C(OC)C=C(C3=C1C2=C(C=C(C=C2OC3=O)O)C)O |
| InChI | 1S/C15H12O5/c1-7-3-8(16)4-12-13(7)10-5-9(19-2)6-11(17)14(10)15(18)20-12/h3-6,16-17H,1-2H3 |
| InChIKey | LCSDQFNUYFTXMT-UHFFFAOYSA-N |
| Density | 1.427g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.169°C at 760 mmHg (Cal.) |
| Flash point | 217.389°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Alternariol Monomethyl Ether |