|
CAS#: 2350-46-1 Product: 1-(2,3-Dichloro-4-Hydroxyphenyl)-1-Butanone No suppilers available for the product. |
| Name | 1-(2,3-Dichloro-4-Hydroxyphenyl)-1-Butanone |
|---|---|
| Synonyms | 1-(2,3-dichloro-4-hydroxyphenyl)butan-1-one |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 |
| CAS Registry Number | 2350-46-1 |
| SMILES | Clc1c(ccc(O)c1Cl)C(=O)CCC |
| InChI | 1S/C10H10Cl2O2/c1-2-3-7(13)6-4-5-8(14)10(12)9(6)11/h4-5,14H,2-3H2,1H3 |
| InChIKey | MRAKITVQDPSLMI-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.716°C at 760 mmHg (Cal.) |
| Flash point | 159.255°C (Cal.) |
| Refractive index | 1.562 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,3-Dichloro-4-Hydroxyphenyl)-1-Butanone |