|
CAS#: 23543-14-8 Product: N-Methyl-2,2',4',5'-Tetrachloroacetanilide No suppilers available for the product. |
| Name | N-Methyl-2,2',4',5'-Tetrachloroacetanilide |
|---|---|
| Synonyms | 2-Chloro-N-Methyl-N-(2,4,5-Trichlorophenyl)Ethanamide; N-Methyl-2,2',4',5'-Tetrachloroacetanilide; Acetanilide, N-Methyl-2,2',4',5'-Tetrachloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7Cl4NO |
| Molecular Weight | 286.97 |
| CAS Registry Number | 23543-14-8 |
| SMILES | C1=C(C(=CC(=C1N(C(CCl)=O)C)Cl)Cl)Cl |
| InChI | 1S/C9H7Cl4NO/c1-14(9(15)4-10)8-3-6(12)5(11)2-7(8)13/h2-3H,4H2,1H3 |
| InChIKey | BPICYJSGBIOZBI-UHFFFAOYSA-N |
| Density | 1.524g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.119°C at 760 mmHg (Cal.) |
| Flash point | 203.647°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-2,2',4',5'-Tetrachloroacetanilide |