Online Database of Chemicals from Around the World
| Name | 1,3,3,4,4,5,5,6,6-Nonafluoro-2-(2,2,2-Trifluoroethoxy)Cyclohexene |
|---|---|
| Synonyms | 1-(2',2',2'-Trifluoroethoxy)Nonafluorocyclohexene; Brn 2397493; Cyclohexene, 1-(2,2,2-Trifluoroethoxy)Nonafluoro- |
| Molecular Structure |  |
| Molecular Formula | C8H2F12O |
| Molecular Weight | 342.08 |
| CAS Registry Number | 2356-01-6 |
| SMILES | C(OC1=C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)F)C(F)(F)F |
| InChI | 1S/C8H2F12O/c9-2-3(21-1-4(10,11)12)6(15,16)8(19,20)7(17,18)5(2,13)14/h1H2 |
| InChIKey | YKHXNYZQQZHKRX-UHFFFAOYSA-N |
| Density | 1.665g/cm3 (Cal.) |
|---|---|
| Boiling point | 156.662°C at 760 mmHg (Cal.) |
| Flash point | 54.586°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,3,4,4,5,5,6,6-Nonafluoro-2-(2,2,2-Trifluoroethoxy)Cyclohexene |
