|
CAS#: 23571-34-8 Product: 5-Isopropyl-1-Methyl-2-Nitro-1H-Imidazole No suppilers available for the product. |
| Name | 5-Isopropyl-1-Methyl-2-Nitro-1H-Imidazole |
|---|---|
| Synonyms | 5-Isopropyl-1-Methyl-2-Nitro-Imidazole; 5-Isopropyl-1-Methyl-2-Nitroimidazole; 1-Methyl-2-Nitro-5-Propan-2-Yl-Imidazole |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 |
| CAS Registry Number | 23571-34-8 |
| SMILES | C1=C([N](C(=N1)[N+]([O-])=O)C)C(C)C |
| InChI | 1S/C7H11N3O2/c1-5(2)6-4-8-7(9(6)3)10(11)12/h4-5H,1-3H3 |
| InChIKey | NOXMCEHYBLYCTK-UHFFFAOYSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.935°C at 760 mmHg (Cal.) |
| Flash point | 142.454°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Isopropyl-1-Methyl-2-Nitro-1H-Imidazole |