|
CAS#: 23585-79-7 Product: 4-Ethyl-1-Methyl-2-Nitro-1H-Imidazole No suppilers available for the product. |
| Name | 4-Ethyl-1-Methyl-2-Nitro-1H-Imidazole |
|---|---|
| Synonyms | 4-Ethyl-1-Methyl-2-Nitro-Imidazole; Imidazole, 4-Ethyl-1-Methyl-2-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 |
| CAS Registry Number | 23585-79-7 |
| SMILES | C1=C(CC)N=C([N]1C)[N+]([O-])=O |
| InChI | 1S/C6H9N3O2/c1-3-5-4-8(2)6(7-5)9(10)11/h4H,3H2,1-2H3 |
| InChIKey | JHUPSALKEOYJJF-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.132°C at 760 mmHg (Cal.) |
| Flash point | 147.411°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethyl-1-Methyl-2-Nitro-1H-Imidazole |