|
CAS#: 23595-40-6 Product: 2-Fluoro-2',4',5'-Trichloroacetanilide No suppilers available for the product. |
| Name | 2-Fluoro-2',4',5'-Trichloroacetanilide |
|---|---|
| Synonyms | 2-Fluoro-N-(2,4,5-Trichlorophenyl)Ethanamide; Brn 2115448; 2-Fluoro-2',4',5'-Trichloroacetanilide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl3FNO |
| Molecular Weight | 256.49 |
| CAS Registry Number | 23595-40-6 |
| SMILES | C1=C(C(=CC(=C1NC(CF)=O)Cl)Cl)Cl |
| InChI | 1S/C8H5Cl3FNO/c9-4-1-6(11)7(2-5(4)10)13-8(14)3-12/h1-2H,3H2,(H,13,14) |
| InChIKey | YVJPREDLAWMTFC-UHFFFAOYSA-N |
| Density | 1.566g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.134°C at 760 mmHg (Cal.) |
| Flash point | 186.118°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Fluoro-2',4',5'-Trichloroacetanilide |