|
CAS#: 23621-79-6 Product: 3,5,5-Trimethylhexanoic Acid, Lead Salt No suppilers available for the product. |
| Name | 3,5,5-Trimethylhexanoic Acid, Lead Salt |
|---|---|
| Synonyms | Plumbous 3,5,5-Trimethylhexanoate; 3,5,5-Trimethylhexanoic Acid, Lead Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C18H34O4Pb |
| Molecular Weight | 521.66 |
| CAS Registry Number | 23621-79-6 |
| EINECS | 245-788-9 |
| SMILES | C(C(C)(C)C)C(CC([O-])=O)C.C(C(C)(C)C)C(CC([O-])=O)C.[Pb++] |
| InChI | 1S/2C9H18O2.Pb/c2*1-7(5-8(10)11)6-9(2,3)4;/h2*7H,5-6H2,1-4H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | HHCUBIIYLQMHJR-UHFFFAOYSA-L |
| Boiling point | 243.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 109.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,5-Trimethylhexanoic Acid, Lead Salt |