|
CAS#: 23656-66-8 Product: 22-Dehydrodesmosterol No suppilers available for the product. |
| Name | 22-Dehydrodesmosterol |
|---|---|
| Synonyms | (3S,8S,9S,10R,13R,14S,17R)-17-[(1R,2E)-1,5-Dimethylhexa-2,4-Dienyl]-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Ol; Cholesta-5,22,24-Trien-3-Ol, (3Beta,22E)-; 22-Dehydrodesmosterol |
| Molecular Structure | ![]() |
| Molecular Formula | C27H42O |
| Molecular Weight | 382.63 |
| CAS Registry Number | 23656-66-8 |
| SMILES | [C@H]34[C@H]1[C@@H]([C@@]2(C(=CC1)C[C@@H](O)CC2)C)CC[C@@]3([C@H](CC4)[C@@H](\C=C\C=C(C)C)C)C |
| InChI | 1S/C27H42O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h6-9,19,21-25,28H,10-17H2,1-5H3/b8-6+/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | NKIFUBKKNVGXKA-OFAYOZIESA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.182°C at 760 mmHg (Cal.) |
| Flash point | 210.781°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 22-Dehydrodesmosterol |