|
CAS#: 23699-84-5 Product: 9,10-Dihydro-2-Methyl-4-(1-Methyl-4-Piperidylidene)-4H-Benzo[5,6]Cyclohept[1,2-d]Oxazole No suppilers available for the product. |
| Name | 9,10-Dihydro-2-Methyl-4-(1-Methyl-4-Piperidylidene)-4H-Benzo[5,6]Cyclohept[1,2-d]Oxazole |
|---|---|
| Synonyms | 9,10-Dihydro-2-Methyl-4-(1-Methyl-4-Piperidylidene)-4H-Benzo(5,6)Cyclohept(1,2-D)Oxazole; Brn 4850608; 4H-Benzo(5,6)Cyclohept(1,2-D)Oxazole, 9,10-Dihydro-2-Methyl-4-(1-Methyl-4-Piperi |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 |
| CAS Registry Number | 23699-84-5 |
| SMILES | C1=CC=CC3=C1C(C2=C(OC(=N2)C)CC3)=C4CCN(CC4)C |
| InChI | 1S/C19H22N2O/c1-13-20-19-17(22-13)8-7-14-5-3-4-6-16(14)18(19)15-9-11-21(2)12-10-15/h3-6H,7-12H2,1-2H3 |
| InChIKey | QCEHDADBIVGNDY-UHFFFAOYSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.775°C at 760 mmHg (Cal.) |
| Flash point | 217.349°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,10-Dihydro-2-Methyl-4-(1-Methyl-4-Piperidylidene)-4H-Benzo[5,6]Cyclohept[1,2-d]Oxazole |