|
CAS#: 23742-02-1 Product: alpha,alpha-Diethyl-3,4-Methylenedioxyphenylacetamide No suppilers available for the product. |
| Name | alpha,alpha-Diethyl-3,4-Methylenedioxyphenylacetamide |
|---|---|
| Synonyms | 2-(1,3-Benzodioxol-5-Yl)-2-Ethyl-Butanamide; 2-(1,3-Benzodioxol-5-Yl)-2-Ethyl-Butyramide; Hoe-264 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 |
| CAS Registry Number | 23742-02-1 |
| SMILES | C2=CC1=C(OCO1)C=C2C(CC)(CC)C(N)=O |
| InChI | 1S/C13H17NO3/c1-3-13(4-2,12(14)15)9-5-6-10-11(7-9)17-8-16-10/h5-7H,3-4,8H2,1-2H3,(H2,14,15) |
| InChIKey | YGLXEIZTNVLZAO-UHFFFAOYSA-N |
| Density | 1.17g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.151°C at 760 mmHg (Cal.) |
| Flash point | 192.164°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha,alpha-Diethyl-3,4-Methylenedioxyphenylacetamide |