Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (1Z,4Z,9Z,14Z)-5,10,15-Tris(2,3,4,5,6-Pentafluorophenyl)-21H-Corrin |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C37H9F15N4 |
| Molecular Weight | 794.47 |
| CAS Registry Number | 238402-21-6 |
| SMILES | c/1c/c/2c(/c3cc/c(/n3)c(/c4cc/c(/n4)c(/c5cc/c(c1/[nH]2)/n5)\c6c(c(c(c(c6F)F)F)F)F)\c7c(c(c(c(c7F)F)F)F)F)\c8c(c(c(c(c8F)F)F)F)F |
| InChI | 1S/C37H9F15N4/c38-23-20(24(39)30(45)35(50)29(23)44)17-11-3-1-9(53-11)10-2-4-12(54-10)18(21-25(40)31(46)36(51)32(47)26(21)41)14-6-8-16(56-14)19(15-7-5-13(17)55-15)22-27(42)33(48)37(52)34(49)28(22)43/h1-8,53H/b10-9-,17-11+,17-13+,18-12+,18-14+,19-15+,19-16+ |
| InChIKey | AVYBSXBGTRSCST-IXCVTHGBSA-N |
| Density | 1.726g/cm3 (Cal.) |
|---|---|
| Boiling point | 755.856°C at 760 mmHg (Cal.) |
| Flash point | 410.927°C (Cal.) |
| Refractive index | 1.626 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1Z,4Z,9Z,14Z)-5,10,15-Tris(2,3,4,5,6-Pentafluorophenyl)-21H-Corrin |