|
CAS#: 23844-98-6 Product: 1,1a,2,5,6,6a,7,7alpha-Octahydro-1,1,6,6alpha-Tetramethyl-4H-Cyclopropa[b]Naphthalen-4-One No suppilers available for the product. |
| Name | 1,1a,2,5,6,6a,7,7alpha-Octahydro-1,1,6,6alpha-Tetramethyl-4H-Cyclopropa[b]Naphthalen-4-One |
|---|---|
| Synonyms | 1,1A,2,5,6,6A,7,7A-Octahydro-1,1,6,6A-Tetramethyl-4H-Cyclopropa(B)Naphthalen-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 |
| CAS Registry Number | 23844-98-6 |
| EINECS | 245-909-5 |
| SMILES | CC1(C3C1CC2=CC(=O)CC(C2(C3)C)C)C |
| InChI | 1S/C15H22O/c1-9-5-11(16)6-10-7-12-13(14(12,2)3)8-15(9,10)4/h6,9,12-13H,5,7-8H2,1-4H3 |
| InChIKey | LVQVBJGXSHXFKV-UHFFFAOYSA-N |
| Density | 1.027g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.699°C at 760 mmHg (Cal.) |
| Flash point | 136.483°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1a,2,5,6,6a,7,7alpha-Octahydro-1,1,6,6alpha-Tetramethyl-4H-Cyclopropa[b]Naphthalen-4-One |