|
CAS#: 2385-81-1 Product: Ethyl 1-[2-(Oxolan-2-Ylmethoxy)Ethyl]-4-Phenylpiperidine-4-Carboxylate No suppilers available for the product. |
| Name | Ethyl 1-[2-(Oxolan-2-Ylmethoxy)Ethyl]-4-Phenylpiperidine-4-Carboxylate |
|---|---|
| Synonyms | Ethyl 4-Phenyl-1-[2-(Tetrahydrofuran-2-Ylmethoxy)Ethyl]Piperidine-4-Carboxylate; 4-Phenyl-1-[2-(2-Tetrahydrofuranylmethoxy)Ethyl]-4-Piperidinecarboxylic Acid Ethyl Ester; 4-Phenyl-1-[2-(Tetrahydrofurfuryloxy)Ethyl]Isonipecotic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 |
| CAS Registry Number | 2385-81-1 |
| EINECS | 219-195-0 |
| SMILES | C3=C(C1(C(OCC)=O)CCN(CC1)CCOCC2CCCO2)C=CC=C3 |
| InChI | 1S/C21H31NO4/c1-2-25-20(23)21(18-7-4-3-5-8-18)10-12-22(13-11-21)14-16-24-17-19-9-6-15-26-19/h3-5,7-8,19H,2,6,9-17H2,1H3 |
| InChIKey | NNCOZXNZFLUYGG-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.3±45.0°C at 760 mmHg (Cal.) |
| Flash point | 238.2±28.7°C (Cal.) |
| Controlled Substance | DEA Drug Code Number: 9626 Details |
|---|---|
| CSA Schedule: I | |
| Is Narcotics? Yes | |
| Market Analysis Reports |
| List of Reports Available for Ethyl 1-[2-(Oxolan-2-Ylmethoxy)Ethyl]-4-Phenylpiperidine-4-Carboxylate |