|
CAS#: 23886-96-6 Product: 1-Chloro-3-(Phenylsulfonyl)Acetone No suppilers available for the product. |
| Name | 1-Chloro-3-(Phenylsulfonyl)Acetone |
|---|---|
| Synonyms | 1-Chloro-3-(phenylsulfonyl)acetone # |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9ClO3S |
| Molecular Weight | 232.68 |
| CAS Registry Number | 23886-96-6 |
| SMILES | O=S(=O)(c1ccccc1)CC(=O)CCl |
| InChI | 1S/C9H9ClO3S/c10-6-8(11)7-14(12,13)9-4-2-1-3-5-9/h1-5H,6-7H2 |
| InChIKey | KYMPNYZODVAUHX-UHFFFAOYSA-N |
| Density | 1.347g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.326°C at 760 mmHg (Cal.) |
| Flash point | 201.958°C (Cal.) |
| Refractive index | 1.543 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-3-(Phenylsulfonyl)Acetone |