|
CAS#: 23923-03-7 Product: 5,6-Dimethoxy-N,N-Dimethyl-2-Naphthalenamine No suppilers available for the product. |
| Name | 5,6-Dimethoxy-N,N-Dimethyl-2-Naphthalenamine |
|---|---|
| Synonyms | 5,6-Dimethoxy-N,N-Dimethyl-Naphthalen-1-Amine; 5,6-Dimethoxy-N,N-Dimethyl-1-Naphthalenamine; (5,6-Dimethoxy-1-Naphthyl)-Dimethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 |
| CAS Registry Number | 23923-03-7 |
| SMILES | C1=CC=C(C2=C1C(=C(C=C2)OC)OC)N(C)C |
| InChI | 1S/C14H17NO2/c1-15(2)12-7-5-6-11-10(12)8-9-13(16-3)14(11)17-4/h5-9H,1-4H3 |
| InChIKey | KUAGFDUGAXZTOU-UHFFFAOYSA-N |
| Density | 1.104g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.159°C at 760 mmHg (Cal.) |
| Flash point | 117.118°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dimethoxy-N,N-Dimethyl-2-Naphthalenamine |