| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Coenzyme Q8 |
|---|---|
| Synonyms | 2,3-Dimethoxy-5-Methyl-6-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27,31-Octamethyldotriaconta-2,6,10,14,18,22,26,30-Octaenyl]Cyclohexa-2,5-Diene-1,4-Dione; 2,3-Dimethoxy-5-Methyl-6-(3,7,11,15,19,23,27,31-Octamethyldotriaconta-2,6,10,14,18,22,26,30-Octaenyl)-1,4-Benzoquinone; 2,3-Dimethoxy-5-Methyl-6-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27,31-Octamethyldotriaconta-2,6,10,14,18,22,26,30-Octaenyl]-1,4-Benzoquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C49H74O4 |
| Molecular Weight | 727.12 |
| CAS Registry Number | 2394-68-5 (20304-10-3) |
| SMILES | C(C1=C(C(C(=C(C1=O)OC)OC)=O)C)/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CCC=C(C)C)C)C)C)C)C)C)C |
| InChI | 1S/C49H74O4/c1-36(2)20-13-21-37(3)22-14-23-38(4)24-15-25-39(5)26-16-27-40(6)28-17-29-41(7)30-18-31-42(8)32-19-33-43(9)34-35-45-44(10)46(50)48(52-11)49(53-12)47(45)51/h20,22,24,26,28,30,32,34H,13-19,21,23,25,27,29,31,33,35H2,1-12H3/b37-22+,38-24+,39-26+,40-28+,41-30+,42-32+,43-34+ |
| InChIKey | ICFIZJQGJAJRSU-SGHXUWJISA-N |
| Density | 0.979g/cm3 (Cal.) |
|---|---|
| Boiling point | 782.867°C at 760 mmHg (Cal.) |
| Flash point | 303.269°C (Cal.) |
| (1) | Megan K. Dorris and Craig E. Lunte. Determination of Co-Q10 in plasma samples by dual-electrode amperometric detection and liquid chromatography, Anal. Methods, 2011, 3, 161. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Coenzyme Q8 |