|
CAS#: 239448-30-7 Product: 1,3-Bis[(Phenylselanyl)Methyl]Benzene No suppilers available for the product. |
| Name | 1,3-Bis[(Phenylselanyl)Methyl]Benzene |
|---|---|
| Synonyms | 1,3-Bis[(phenylseleno)methyl]benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18Se2 |
| Molecular Weight | 416.28 |
| CAS Registry Number | 239448-30-7 |
| SMILES | [Se](c1ccccc1)Cc2cccc(c2)C[Se]c3ccccc3 |
| InChI | 1S/C20H18Se2/c1-3-10-19(11-4-1)21-15-17-8-7-9-18(14-17)16-22-20-12-5-2-6-13-20/h1-14H,15-16H2 |
| InChIKey | KNRBPZAUCBNUPW-UHFFFAOYSA-N |
| Boiling point | 506.709°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 260.249°C (Cal.) |
| Refractive index | (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis[(Phenylselanyl)Methyl]Benzene |